C16H20F2N2O3 — CID 94822453
(E)-3-[2-(difluoromethoxy)phenyl]-N-[[(2R)-4-methylmorpholin-2-yl]methyl]prop-2-enamide (PubChem CID 94822453) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[[(2R)-4-methylmorpholin-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[[(2R)-4-methylmorpholin-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 94822453 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[[(2R)-4-methylmorpholin-2-yl]methyl]prop-2-enamide |
| SMILES | CN1CCO[C@H](CNC(=O)/C=C/c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C16H20F2N2O3/c1-20-8-9-22-13(11-20)10-19-15(21)7-6-12-4-2-3-5-14(12)23-16(17)18/h2-7,13,16H,8-11H2,1H3,(H,19,21)/b7-6+/t13-/m1/s1 |
| InChIKey | GAQLNJMUTMRIJS-KTRBRXNASA-N |
| XLogP | 1.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|