C20H29F2N3O2 — CID 78871206
3-[2-(difluoromethoxy)phenyl]-N-[4-(4-ethylpiperazin-1-yl)butyl]prop-2-enamide (PubChem CID 78871206) has the molecular formula C20H29F2N3O2 and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-N-[4-(4-ethylpiperazin-1-yl)butyl]prop-2-enamide.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-N-[4-(4-ethylpiperazin-1-yl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 78871206 |
| Molecular Formula | C20H29F2N3O2 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-N-[4-(4-ethylpiperazin-1-yl)butyl]prop-2-enamide |
| SMILES | CCN1CCN(CCCCNC(=O)C=Cc2ccccc2OC(F)F)CC1 |
| InChI | InChI=1S/C20H29F2N3O2/c1-2-24-13-15-25(16-14-24)12-6-5-11-23-19(26)10-9-17-7-3-4-8-18(17)27-20(21)22/h3-4,7-10,20H,2,5-6,11-16H2,1H3,(H,23,26) |
| InChIKey | XGCVCQMBJROGJM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|