C15H17F2NO4 — CID 43052706
methyl 4-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]butanoate (PubChem CID 43052706) has the molecular formula C15H17F2NO4 and a molecular weight of 313.30 g/mol. Its IUPAC name is methyl 4-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]butanoate.
| Compound Name | methyl 4-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 43052706 |
| Molecular Formula | C15H17F2NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | methyl 4-[[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)/C=C/c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H17F2NO4/c1-21-14(20)7-4-10-18-13(19)9-8-11-5-2-3-6-12(11)22-15(16)17/h2-3,5-6,8-9,15H,4,7,10H2,1H3,(H,18,19)/b9-8+ |
| InChIKey | PPQGYUKDFQIXGI-CMDGGOBGSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|