C15H21ClN2O3 — CID 94815626
(2R)-2-(2-chlorophenoxy)-N-[[(2R)-4-methylmorpholin-2-yl]methyl]propanamide (PubChem CID 94815626) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenoxy)-N-[[(2R)-4-methylmorpholin-2-yl]methyl]propanamide.
| Compound Name | (2R)-2-(2-chlorophenoxy)-N-[[(2R)-4-methylmorpholin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 94815626 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2R)-2-(2-chlorophenoxy)-N-[[(2R)-4-methylmorpholin-2-yl]methyl]propanamide |
| SMILES | C[C@@H](Oc1ccccc1Cl)C(=O)NC[C@@H]1CN(C)CCO1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-11(21-14-6-4-3-5-13(14)16)15(19)17-9-12-10-18(2)7-8-20-12/h3-6,11-12H,7-10H2,1-2H3,(H,17,19)/t11-,12-/m1/s1 |
| InChIKey | YOEFIGIDLRUVLB-VXGBXAGGSA-N |
| XLogP | 1.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |