C20H26FN3O3 — CID 86993305
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[1-(5-methylfuran-2-yl)ethyl]urea (PubChem CID 86993305) has the molecular formula C20H26FN3O3 and a molecular weight of 375.44 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[1-(5-methylfuran-2-yl)ethyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[1-(5-methylfuran-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 86993305 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[1-(5-methylfuran-2-yl)ethyl]urea |
| SMILES | Cc1ccc(C(C)NC(=O)NCC(c2ccc(F)cc2)N2CCOCC2)o1 |
| InChI | InChI=1S/C20H26FN3O3/c1-14-3-8-19(27-14)15(2)23-20(25)22-13-18(24-9-11-26-12-10-24)16-4-6-17(21)7-5-16/h3-8,15,18H,9-13H2,1-2H3,(H2,22,23,25) |
| InChIKey | RQVMSVLCHIKIFD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |