C15H19Cl2FN2O2 — CID 3673625
2,2-dichloro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]propanamide (PubChem CID 3673625) has the molecular formula C15H19Cl2FN2O2 and a molecular weight of 349.23 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]propanamide.
| Compound Name | 2,2-dichloro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]propanamide |
|---|---|
| PubChem CID | 3673625 |
| Molecular Formula | C15H19Cl2FN2O2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2,2-dichloro-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]propanamide |
| SMILES | CC(Cl)(Cl)C(=O)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C15H19Cl2FN2O2/c1-15(16,17)14(21)19-10-13(20-6-8-22-9-7-20)11-2-4-12(18)5-3-11/h2-5,13H,6-10H2,1H3,(H,19,21) |
| InChIKey | IQKNGQDIFVQNJF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|