C24H26FN3O2S — CID 60548774
1-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]urea (PubChem CID 60548774) has the molecular formula C24H26FN3O2S and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 60548774 |
| Molecular Formula | C24H26FN3O2S |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 1-[(4-fluorophenyl)-thiophen-2-ylmethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(CN2CCOCC2)c1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C24H26FN3O2S/c25-21-8-6-20(7-9-21)23(22-5-2-14-31-22)27-24(29)26-16-18-3-1-4-19(15-18)17-28-10-12-30-13-11-28/h1-9,14-15,23H,10-13,16-17H2,(H2,26,27,29) |
| InChIKey | MDHGJQCZBMFLSI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |