C23H22F2N2O2S — CID 46571477
2-[2-(4-fluorophenyl)morpholin-4-yl]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide (PubChem CID 46571477) has the molecular formula C23H22F2N2O2S and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)morpholin-4-yl]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)morpholin-4-yl]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
|---|---|
| PubChem CID | 46571477 |
| Molecular Formula | C23H22F2N2O2S |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 2-[2-(4-fluorophenyl)morpholin-4-yl]-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
| SMILES | O=C(CN1CCOC(c2ccc(F)cc2)C1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C23H22F2N2O2S/c24-18-7-3-16(4-8-18)20-14-27(11-12-29-20)15-22(28)26-23(21-2-1-13-30-21)17-5-9-19(25)10-6-17/h1-10,13,20,23H,11-12,14-15H2,(H,26,28) |
| InChIKey | ABWSFLLKZJMYOS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |