C21H23Cl2FN2O — CID 25439790
N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 25439790) has the molecular formula C21H23Cl2FN2O and a molecular weight of 409.33 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 25439790 |
| Molecular Formula | C21H23Cl2FN2O |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(CN2CCCCC2)cc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H23Cl2FN2O/c1-14(17-11-20(24)19(23)12-18(17)22)25-21(27)16-7-5-15(6-8-16)13-26-9-3-2-4-10-26/h5-8,11-12,14H,2-4,9-10,13H2,1H3,(H,25,27)/t14-/m0/s1 |
| InChIKey | CCJKHLQVJYFQTG-AWEZNQCLSA-N |
| XLogP | 5.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|