C16H22Cl2FN3O — CID 55770177
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-(2-piperidin-1-ylethyl)urea (PubChem CID 55770177) has the molecular formula C16H22Cl2FN3O and a molecular weight of 362.28 g/mol. Its IUPAC name is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-(2-piperidin-1-ylethyl)urea.
| Compound Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-(2-piperidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 55770177 |
| Molecular Formula | C16H22Cl2FN3O |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-(2-piperidin-1-ylethyl)urea |
| SMILES | CC(NC(=O)NCCN1CCCCC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H22Cl2FN3O/c1-11(12-9-15(19)14(18)10-13(12)17)21-16(23)20-5-8-22-6-3-2-4-7-22/h9-11H,2-8H2,1H3,(H2,20,21,23) |
| InChIKey | MCGZLUIBZONUIJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|