C17H19Cl2FN4O — CID 112831895
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea (PubChem CID 112831895) has the molecular formula C17H19Cl2FN4O and a molecular weight of 385.27 g/mol. Its IUPAC name is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea.
| Compound Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea |
|---|---|
| PubChem CID | 112831895 |
| Molecular Formula | C17H19Cl2FN4O |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea |
| SMILES | CC(NC(=O)NCCCNc1ccccn1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2FN4O/c1-11(12-9-15(20)14(19)10-13(12)18)24-17(25)23-8-4-7-22-16-5-2-3-6-21-16/h2-3,5-6,9-11H,4,7-8H2,1H3,(H,21,22)(H2,23,24,25) |
| InChIKey | JWUNPWXVICHINF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|