About 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea (PubChem CID 112831895) has the molecular formula C17H19Cl2FN4O
and a molecular weight of 385.27 g/mol. Its IUPAC name is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea.
Molecular Properties
| Compound Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea |
| PubChem CID | 112831895 |
| Molecular Formula | C17H19Cl2FN4O |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea |
| SMILES | CC(NC(=O)NCCCNc1ccccn1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2FN4O/c1-11(12-9-15(20)14(19)10-13(12)18)24-17(25)23-8-4-7-22-16-5-2-3-6-21-16/h2-3,5-6,9-11H,4,7-8H2,1H3,(H,21,22)(H2,23,24,25) |
| InChIKey | JWUNPWXVICHINF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea?
The IUPAC name of 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea (CID 112831895) is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea.
What is the SMILES notation for 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea?
The canonical SMILES for 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea is CC(NC(=O)NCCCNc1ccccn1)c1cc(F)c(Cl)cc1Cl.
What is the InChIKey of 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea?
The InChIKey is JWUNPWXVICHINF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Cl2FN4O/c1-11(12-9-15(20)14(19)10-13(12)18)24-17(25)23-8-4-7-22-16-5-2-3-6-21-16/h2-3,5-6,9-11H,4,7-8H2,1H3,(H,21,22)(H2,23,24,25).
What are the key properties of 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea?
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea has a molecular weight of 385.27 g/mol, XLogP of 4.39, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(pyridin-2-ylamino)propyl]urea is sourced from PubChem (CID 112831895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).