C17H23Cl2FN2O3 — CID 9187263
tert-butyl N-[4-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-4-oxobutyl]carbamate (PubChem CID 9187263) has the molecular formula C17H23Cl2FN2O3 and a molecular weight of 393.29 g/mol. Its IUPAC name is tert-butyl N-[4-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 9187263 |
| Molecular Formula | C17H23Cl2FN2O3 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | tert-butyl N-[4-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-4-oxobutyl]carbamate |
| SMILES | C[C@H](NC(=O)CCCNC(=O)OC(C)(C)C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H23Cl2FN2O3/c1-10(11-8-14(20)13(19)9-12(11)18)22-15(23)6-5-7-21-16(24)25-17(2,3)4/h8-10H,5-7H2,1-4H3,(H,21,24)(H,22,23)/t10-/m0/s1 |
| InChIKey | ADHPGDBRWFZFKS-JTQLQIEISA-N |
| XLogP | 4.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|