C13H18Cl3FN2O — CID 119686394
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119686394) has the molecular formula C13H18Cl3FN2O and a molecular weight of 343.66 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119686394 |
| Molecular Formula | C13H18Cl3FN2O |
| Molecular Weight | 343.66 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NC(C)c1cc(F)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C13H17Cl2FN2O.ClH/c1-8(18-13(19)4-3-5-17-2)9-6-12(16)11(15)7-10(9)14;/h6-8,17H,3-5H2,1-2H3,(H,18,19);1H |
| InChIKey | PTGIZJHICQKNKP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|