C16H16Cl2FNOS — CID 112764256
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-thiophen-2-ylbutanamide (PubChem CID 112764256) has the molecular formula C16H16Cl2FNOS and a molecular weight of 360.28 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 112764256 |
| Molecular Formula | C16H16Cl2FNOS |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-thiophen-2-ylbutanamide |
| SMILES | CC(NC(=O)CCCc1cccs1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2FNOS/c1-10(12-8-15(19)14(18)9-13(12)17)20-16(21)6-2-4-11-5-3-7-22-11/h3,5,7-10H,2,4,6H2,1H3,(H,20,21) |
| InChIKey | LZGQLLGTQRBPTG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|