C19H20Cl2FNO3 — CID 112764247
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-(3,4-dimethoxyphenyl)propanamide (PubChem CID 112764247) has the molecular formula C19H20Cl2FNO3 and a molecular weight of 400.28 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 112764247 |
| Molecular Formula | C19H20Cl2FNO3 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NC(C)c2cc(F)c(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C19H20Cl2FNO3/c1-11(13-9-16(22)15(21)10-14(13)20)23-19(24)7-5-12-4-6-17(25-2)18(8-12)26-3/h4,6,8-11H,5,7H2,1-3H3,(H,23,24) |
| InChIKey | KTCXZQZQLAUUQN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|