C19H21Cl2NO3 — CID 133219990
3-(3,4-dichlorophenyl)-N-[1-(2,5-dimethoxyphenyl)ethyl]propanamide (PubChem CID 133219990) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[1-(2,5-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[1-(2,5-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 133219990 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[1-(2,5-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)CCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H21Cl2NO3/c1-12(15-11-14(24-2)6-8-18(15)25-3)22-19(23)9-5-13-4-7-16(20)17(21)10-13/h4,6-8,10-12H,5,9H2,1-3H3,(H,22,23) |
| InChIKey | IDOGLGCFNSOGST-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |