C12H14Cl2FNO2 — CID 60782893
4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]butanoic acid (PubChem CID 60782893) has the molecular formula C12H14Cl2FNO2 and a molecular weight of 294.15 g/mol. Its IUPAC name is 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]butanoic acid.
| Compound Name | 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 60782893 |
| Molecular Formula | C12H14Cl2FNO2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]butanoic acid |
| SMILES | CC(NCCCC(=O)O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2FNO2/c1-7(16-4-2-3-12(17)18)8-5-11(15)10(14)6-9(8)13/h5-7,16H,2-4H2,1H3,(H,17,18) |
| InChIKey | IHSZLNVBZSGBED-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|