C12H14Cl2FN3O2 — CID 8639839
2-[[2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]acetamide (PubChem CID 8639839) has the molecular formula C12H14Cl2FN3O2 and a molecular weight of 322.17 g/mol. Its IUPAC name is 2-[[2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]acetamide.
| Compound Name | 2-[[2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 8639839 |
| Molecular Formula | C12H14Cl2FN3O2 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-[[2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)NCC(N)=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2FN3O2/c1-6(17-5-12(20)18-4-11(16)19)7-2-10(15)9(14)3-8(7)13/h2-3,6,17H,4-5H2,1H3,(H2,16,19)(H,18,20)/t6-/m1/s1 |
| InChIKey | FZVBTSVSUNZAMG-ZCFIWIBFSA-N |
| XLogP | 1.38 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|