C18H17Cl2FN2O2 — CID 9377442
N-(3-acetylphenyl)-2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide (PubChem CID 9377442) has the molecular formula C18H17Cl2FN2O2 and a molecular weight of 383.25 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9377442 |
| Molecular Formula | C18H17Cl2FN2O2 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-(3-acetylphenyl)-2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CN[C@@H](C)c2cc(F)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H17Cl2FN2O2/c1-10(14-7-17(21)16(20)8-15(14)19)22-9-18(25)23-13-5-3-4-12(6-13)11(2)24/h3-8,10,22H,9H2,1-2H3,(H,23,25)/t10-/m0/s1 |
| InChIKey | XVWMKTXGOCIADR-JTQLQIEISA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|