C17H14Cl2FN3O — CID 9377756
N-(4-cyanophenyl)-2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide (PubChem CID 9377756) has the molecular formula C17H14Cl2FN3O and a molecular weight of 366.22 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide.
| Compound Name | N-(4-cyanophenyl)-2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9377756 |
| Molecular Formula | C17H14Cl2FN3O |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-(4-cyanophenyl)-2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccc(C#N)cc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2FN3O/c1-10(13-6-16(20)15(19)7-14(13)18)22-9-17(24)23-12-4-2-11(8-21)3-5-12/h2-7,10,22H,9H2,1H3,(H,23,24)/t10-/m1/s1 |
| InChIKey | VQPAIKLNVUOWNB-SNVBAGLBSA-N |
| XLogP | 4.29 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|