C18H16Cl2FN3OS — CID 9377300
N-[2-(cyanomethylsulfanyl)phenyl]-2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide (PubChem CID 9377300) has the molecular formula C18H16Cl2FN3OS and a molecular weight of 412.32 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9377300 |
| Molecular Formula | C18H16Cl2FN3OS |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccccc1SCC#N)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2FN3OS/c1-11(12-8-15(21)14(20)9-13(12)19)23-10-18(25)24-16-4-2-3-5-17(16)26-7-6-22/h2-5,8-9,11,23H,7,10H2,1H3,(H,24,25)/t11-/m1/s1 |
| InChIKey | HBYCIKUJNCZTMX-LLVKDONJSA-N |
| XLogP | 5.04 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|