C18H18ClN3OS — CID 9307543
2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-[2-(cyanomethylsulfanyl)phenyl]acetamide (PubChem CID 9307543) has the molecular formula C18H18ClN3OS and a molecular weight of 359.88 g/mol. Its IUPAC name is 2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-[2-(cyanomethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-[2-(cyanomethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9307543 |
| Molecular Formula | C18H18ClN3OS |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-[2-(cyanomethylsulfanyl)phenyl]acetamide |
| SMILES | C[C@H](NCC(=O)Nc1ccccc1SCC#N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H18ClN3OS/c1-13(14-5-4-6-15(19)11-14)21-12-18(23)22-16-7-2-3-8-17(16)24-10-9-20/h2-8,11,13,21H,10,12H2,1H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | LPKBJJLJEBWPCL-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |