C17H16Cl2F2N2O — CID 9377837
2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(2-fluoro-4-methylphenyl)acetamide (PubChem CID 9377837) has the molecular formula C17H16Cl2F2N2O and a molecular weight of 373.23 g/mol. Its IUPAC name is 2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(2-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(2-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9377837 |
| Molecular Formula | C17H16Cl2F2N2O |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(2-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN[C@H](C)c2cc(F)c(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C17H16Cl2F2N2O/c1-9-3-4-16(15(21)5-9)23-17(24)8-22-10(2)11-6-14(20)13(19)7-12(11)18/h3-7,10,22H,8H2,1-2H3,(H,23,24)/t10-/m1/s1 |
| InChIKey | JKLKQOVGPWIGKM-SNVBAGLBSA-N |
| XLogP | 4.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|