C19H19Cl2FN2O3 — CID 9377192
methyl 3-[[2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]-4-methylbenzoate (PubChem CID 9377192) has the molecular formula C19H19Cl2FN2O3 and a molecular weight of 413.28 g/mol. Its IUPAC name is methyl 3-[[2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 9377192 |
| Molecular Formula | C19H19Cl2FN2O3 |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | methyl 3-[[2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)CN[C@@H](C)c2cc(F)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H19Cl2FN2O3/c1-10-4-5-12(19(26)27-3)6-17(10)24-18(25)9-23-11(2)13-7-16(22)15(21)8-14(13)20/h4-8,11,23H,9H2,1-3H3,(H,24,25)/t11-/m0/s1 |
| InChIKey | SOSCDPQTGIUKEZ-NSHDSACASA-N |
| XLogP | 4.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|