C17H16Cl2FN3O2 — CID 8639730
2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(phenylcarbamoyl)acetamide (PubChem CID 8639730) has the molecular formula C17H16Cl2FN3O2 and a molecular weight of 384.24 g/mol. Its IUPAC name is 2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(phenylcarbamoyl)acetamide.
| Compound Name | 2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(phenylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8639730 |
| Molecular Formula | C17H16Cl2FN3O2 |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(phenylcarbamoyl)acetamide |
| SMILES | C[C@H](NCC(=O)NC(=O)Nc1ccccc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2FN3O2/c1-10(12-7-15(20)14(19)8-13(12)18)21-9-16(24)23-17(25)22-11-5-3-2-4-6-11/h2-8,10,21H,9H2,1H3,(H2,22,23,24,25)/t10-/m0/s1 |
| InChIKey | KRPPEJWXOJWTSH-JTQLQIEISA-N |
| XLogP | 4.13 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|