C18H18Cl2FN3O2 — CID 8639816
3-[[2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]-N-methylbenzamide (PubChem CID 8639816) has the molecular formula C18H18Cl2FN3O2 and a molecular weight of 398.27 g/mol. Its IUPAC name is 3-[[2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 8639816 |
| Molecular Formula | C18H18Cl2FN3O2 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-[[2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]acetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CN[C@@H](C)c2cc(F)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl2FN3O2/c1-10(13-7-16(21)15(20)8-14(13)19)23-9-17(25)24-12-5-3-4-11(6-12)18(26)22-2/h3-8,10,23H,9H2,1-2H3,(H,22,26)(H,24,25)/t10-/m0/s1 |
| InChIKey | VUBTYDXNBWFEQH-JTQLQIEISA-N |
| XLogP | 3.78 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|