C17H16Cl2FN3O3 — CID 9377822
2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(2-methyl-6-nitrophenyl)acetamide (PubChem CID 9377822) has the molecular formula C17H16Cl2FN3O3 and a molecular weight of 400.24 g/mol. Its IUPAC name is 2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(2-methyl-6-nitrophenyl)acetamide.
| Compound Name | 2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(2-methyl-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9377822 |
| Molecular Formula | C17H16Cl2FN3O3 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-N-(2-methyl-6-nitrophenyl)acetamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)CN[C@@H](C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2FN3O3/c1-9-4-3-5-15(23(25)26)17(9)22-16(24)8-21-10(2)11-6-14(20)13(19)7-12(11)18/h3-7,10,21H,8H2,1-2H3,(H,22,24)/t10-/m0/s1 |
| InChIKey | NGIZIQZRXNRVGL-JTQLQIEISA-N |
| XLogP | 4.64 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|