C18H19Cl2FN3O3+ — CID 8710709
[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]azanium (PubChem CID 8710709) has the molecular formula C18H19Cl2FN3O3+ and a molecular weight of 415.27 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8710709 |
| Molecular Formula | C18H19Cl2FN3O3+ |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)C[NH2+][C@H](C)c2cc(F)c(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C18H18Cl2FN3O3/c1-9-4-5-16(24(26)27)18(10(9)2)23-17(25)8-22-11(3)12-6-15(21)14(20)7-13(12)19/h4-7,11,22H,8H2,1-3H3,(H,23,25)/p+1/t11-/m1/s1 |
| InChIKey | DOAQPOUKAFGITF-LLVKDONJSA-O |
| XLogP | 3.92 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|