C15H13Cl2FN3OS+ — CID 9377850
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]azanium (PubChem CID 9377850) has the molecular formula C15H13Cl2FN3OS+ and a molecular weight of 373.26 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]azanium.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9377850 |
| Molecular Formula | C15H13Cl2FN3OS+ |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1sccc1C#N)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FN3OS/c1-8(10-4-13(18)12(17)5-11(10)16)20-7-14(22)21-15-9(6-19)2-3-23-15/h2-5,8,20H,7H2,1H3,(H,21,22)/p+1/t8-/m0/s1 |
| InChIKey | LVTMMUXJFVLLKX-QMMMGPOBSA-O |
| XLogP | 3.33 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|