C13H14N3O2S+ — CID 8919655
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8919655) has the molecular formula C13H14N3O2S+ and a molecular weight of 276.34 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8919655 |
| Molecular Formula | C13H14N3O2S+ |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1sccc1C#N)c1ccco1 |
| InChI | InChI=1S/C13H13N3O2S/c1-9(11-3-2-5-18-11)15-8-12(17)16-13-10(7-14)4-6-19-13/h2-6,9,15H,8H2,1H3,(H,16,17)/p+1/t9-/m0/s1 |
| InChIKey | IMHQEAKQXAEDGE-VIFPVBQESA-O |
| XLogP | 1.48 |
| TPSA | 82.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |