C20H17ClN3OS+ — CID 9263577
[(S)-(4-chlorophenyl)-phenylmethyl]-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]azanium (PubChem CID 9263577) has the molecular formula C20H17ClN3OS+ and a molecular weight of 382.90 g/mol. Its IUPAC name is [(S)-(4-chlorophenyl)-phenylmethyl]-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]azanium.
| Compound Name | [(S)-(4-chlorophenyl)-phenylmethyl]-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9263577 |
| Molecular Formula | C20H17ClN3OS+ |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | [(S)-(4-chlorophenyl)-phenylmethyl]-[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl]azanium |
| SMILES | N#Cc1ccsc1NC(=O)C[NH2+][C@@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16ClN3OS/c21-17-8-6-15(7-9-17)19(14-4-2-1-3-5-14)23-13-18(25)24-20-16(12-22)10-11-26-20/h1-11,19,23H,13H2,(H,24,25)/p+1/t19-/m0/s1 |
| InChIKey | NWEYXLVRFJAKML-IBGZPJMESA-O |
| XLogP | 3.56 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |