C15H21Cl2FN3O2+ — CID 8639847
[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl]azanium (PubChem CID 8639847) has the molecular formula C15H21Cl2FN3O2+ and a molecular weight of 365.26 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl]azanium.
| Compound Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8639847 |
| Molecular Formula | C15H21Cl2FN3O2+ |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[2-oxo-2-[[2-oxo-2-(propan-2-ylamino)ethyl]amino]ethyl]azanium |
| SMILES | CC(C)NC(=O)CNC(=O)C[NH2+][C@H](C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2FN3O2/c1-8(2)21-15(23)7-20-14(22)6-19-9(3)10-4-13(18)12(17)5-11(10)16/h4-5,8-9,19H,6-7H2,1-3H3,(H,20,22)(H,21,23)/p+1/t9-/m1/s1 |
| InChIKey | RQJZQHQOQXUAEQ-SECBINFHSA-O |
| XLogP | 1.40 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|