C13H18Cl2FN2O+ — CID 8639633
[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium (PubChem CID 8639633) has the molecular formula C13H18Cl2FN2O+ and a molecular weight of 308.20 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8639633 |
| Molecular Formula | C13H18Cl2FN2O+ |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium |
| SMILES | CCNC(=O)[C@H](C)[NH2+][C@H](C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2FN2O/c1-4-17-13(19)8(3)18-7(2)9-5-12(16)11(15)6-10(9)14/h5-8,18H,4H2,1-3H3,(H,17,19)/p+1/t7-,8+/m1/s1 |
| InChIKey | JIXXMKJAMFAQJI-SFYZADRCSA-O |
| XLogP | 2.28 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|