C14H17Cl2FN3O2+ — CID 8639875
[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2S)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl]azanium (PubChem CID 8639875) has the molecular formula C14H17Cl2FN3O2+ and a molecular weight of 349.21 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2S)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl]azanium.
| Compound Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2S)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8639875 |
| Molecular Formula | C14H17Cl2FN3O2+ |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2S)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl]azanium |
| SMILES | C[C@H]([NH2+][C@H](C)c1cc(F)c(Cl)cc1Cl)C(=O)N1CCNC1=O |
| InChI | InChI=1S/C14H16Cl2FN3O2/c1-7(9-5-12(17)11(16)6-10(9)15)19-8(2)13(21)20-4-3-18-14(20)22/h5-8,19H,3-4H2,1-2H3,(H,18,22)/p+1/t7-,8+/m1/s1 |
| InChIKey | BDXMWOUNIWEBJK-SFYZADRCSA-O |
| XLogP | 1.70 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|