C14H18Cl2FN2O+ — CID 8639422
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]azanium (PubChem CID 8639422) has the molecular formula C14H18Cl2FN2O+ and a molecular weight of 320.22 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]azanium.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 8639422 |
| Molecular Formula | C14H18Cl2FN2O+ |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]azanium |
| SMILES | C[C@H]([NH2+][C@H](C)c1cc(F)c(Cl)cc1Cl)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H17Cl2FN2O/c1-7(10-5-13(17)12(16)6-11(10)15)18-8(2)14(20)19-9-3-4-9/h5-9,18H,3-4H2,1-2H3,(H,19,20)/p+1/t7-,8+/m1/s1 |
| InChIKey | MIPUCCNSHJQMLW-SFYZADRCSA-O |
| XLogP | 2.42 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|