C16H18Cl2FNO3 — CID 8651306
[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8651306) has the molecular formula C16H18Cl2FNO3 and a molecular weight of 362.23 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8651306 |
| Molecular Formula | C16H18Cl2FNO3 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(F)c(Cl)cc1Cl)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H18Cl2FNO3/c1-9(15(21)20-10-5-3-2-4-6-10)23-16(22)11-7-14(19)13(18)8-12(11)17/h7-10H,2-6H2,1H3,(H,20,21)/t9-/m1/s1 |
| InChIKey | FIIYRISASDMKPC-SECBINFHSA-N |
| XLogP | 4.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|