C19H22Cl2FN2O2+ — CID 8639404
[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2R)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl]azanium (PubChem CID 8639404) has the molecular formula C19H22Cl2FN2O2+ and a molecular weight of 400.30 g/mol. Its IUPAC name is [(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2R)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl]azanium.
| Compound Name | [(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2R)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8639404 |
| Molecular Formula | C19H22Cl2FN2O2+ |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2R)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl]azanium |
| SMILES | COc1ccc(CNC(=O)[C@@H](C)[NH2+][C@@H](C)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2FN2O2/c1-11(15-8-18(22)17(21)9-16(15)20)24-12(2)19(25)23-10-13-4-6-14(26-3)7-5-13/h4-9,11-12,24H,10H2,1-3H3,(H,23,25)/p+1/t11-,12+/m0/s1 |
| InChIKey | XNDKJDFWGFZJCV-NWDGAFQWSA-O |
| XLogP | 3.47 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|