C13H17Cl2FN3O2+ — CID 9377226
[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium (PubChem CID 9377226) has the molecular formula C13H17Cl2FN3O2+ and a molecular weight of 337.20 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9377226 |
| Molecular Formula | C13H17Cl2FN3O2+ |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl]azanium |
| SMILES | CNC(=O)NC(=O)[C@@H](C)[NH2+][C@H](C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2FN3O2/c1-6(8-4-11(16)10(15)5-9(8)14)18-7(2)12(20)19-13(21)17-3/h4-7,18H,1-3H3,(H2,17,19,20,21)/p+1/t6-,7-/m1/s1 |
| InChIKey | VOSCBTQOLFUVAA-RNFRBKRXSA-O |
| XLogP | 1.60 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|