C12H11ClF2N2O4 — CID 8753061
[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 8753061) has the molecular formula C12H11ClF2N2O4 and a molecular weight of 320.68 g/mol. Its IUPAC name is [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 8753061 |
| Molecular Formula | C12H11ClF2N2O4 |
| Molecular Weight | 320.68 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | CNC(=O)NC(=O)[C@H](C)OC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H11ClF2N2O4/c1-5(10(18)17-12(20)16-2)21-11(19)6-3-8(14)9(15)4-7(6)13/h3-5H,1-2H3,(H2,16,17,18,20)/t5-/m0/s1 |
| InChIKey | PGLTXTJUGFQZKV-YFKPBYRVSA-N |
| XLogP | 1.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.68 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|