C15H17Cl2FN2O4 — CID 8958755
[(2S)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8958755) has the molecular formula C15H17Cl2FN2O4 and a molecular weight of 379.22 g/mol. Its IUPAC name is [(2S)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [(2S)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8958755 |
| Molecular Formula | C15H17Cl2FN2O4 |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [(2S)-1-(tert-butylcarbamoylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(F)c(Cl)cc1Cl)C(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H17Cl2FN2O4/c1-7(12(21)19-14(23)20-15(2,3)4)24-13(22)8-5-11(18)10(17)6-9(8)16/h5-7H,1-4H3,(H2,19,20,21,23)/t7-/m0/s1 |
| InChIKey | JBQQGSSCAYXUPG-ZETCQYMHSA-N |
| XLogP | 3.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|