C18H15Cl2FN2O4 — CID 8958752
[(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8958752) has the molecular formula C18H15Cl2FN2O4 and a molecular weight of 413.23 g/mol. Its IUPAC name is [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8958752 |
| Molecular Formula | C18H15Cl2FN2O4 |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(F)c(Cl)cc1Cl)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H15Cl2FN2O4/c1-10(27-17(25)12-7-15(21)14(20)8-13(12)19)16(24)23-18(26)22-9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H2,22,23,24,26)/t10-/m0/s1 |
| InChIKey | CYMJHXKGRJWLIP-JTQLQIEISA-N |
| XLogP | 3.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|