C16H16Cl2N3O3+ — CID 9254285
[(1R)-1-(2,4-dichlorophenyl)ethyl]-[2-(2-nitroanilino)-2-oxoethyl]azanium (PubChem CID 9254285) has the molecular formula C16H16Cl2N3O3+ and a molecular weight of 369.23 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichlorophenyl)ethyl]-[2-(2-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(2,4-dichlorophenyl)ethyl]-[2-(2-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9254285 |
| Molecular Formula | C16H16Cl2N3O3+ |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [(1R)-1-(2,4-dichlorophenyl)ethyl]-[2-(2-nitroanilino)-2-oxoethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1ccccc1[N+](=O)[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl2N3O3/c1-10(12-7-6-11(17)8-13(12)18)19-9-16(22)20-14-4-2-3-5-15(14)21(23)24/h2-8,10,19H,9H2,1H3,(H,20,22)/p+1/t10-/m1/s1 |
| InChIKey | QYQRBYUWMWCSGO-SNVBAGLBSA-O |
| XLogP | 3.16 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|