C12H16Cl2FNO — CID 106840626
4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]butan-1-ol (PubChem CID 106840626) has the molecular formula C12H16Cl2FNO and a molecular weight of 280.17 g/mol. Its IUPAC name is 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]butan-1-ol.
| Compound Name | 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 106840626 |
| Molecular Formula | C12H16Cl2FNO |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]butan-1-ol |
| SMILES | CC(NCCCCO)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2FNO/c1-8(16-4-2-3-5-17)9-6-12(15)11(14)7-10(9)13/h6-8,16-17H,2-5H2,1H3 |
| InChIKey | QOVOPTPSJQBUHQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|