C15H22Cl2FNO — CID 103787427
3-[[1-(2,4-dichloro-5-fluorophenyl)ethylamino]methyl]hexan-1-ol (PubChem CID 103787427) has the molecular formula C15H22Cl2FNO and a molecular weight of 322.25 g/mol. Its IUPAC name is 3-[[1-(2,4-dichloro-5-fluorophenyl)ethylamino]methyl]hexan-1-ol.
| Compound Name | 3-[[1-(2,4-dichloro-5-fluorophenyl)ethylamino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 103787427 |
| Molecular Formula | C15H22Cl2FNO |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-[[1-(2,4-dichloro-5-fluorophenyl)ethylamino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H22Cl2FNO/c1-3-4-11(5-6-20)9-19-10(2)12-7-15(18)14(17)8-13(12)16/h7-8,10-11,19-20H,3-6,9H2,1-2H3 |
| InChIKey | VNPSOZKCJCSYEK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|