C13H18Cl2FNO2 — CID 103935669
2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-2-ethylpropane-1,3-diol (PubChem CID 103935669) has the molecular formula C13H18Cl2FNO2 and a molecular weight of 310.20 g/mol. Its IUPAC name is 2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-2-ethylpropane-1,3-diol.
| Compound Name | 2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 103935669 |
| Molecular Formula | C13H18Cl2FNO2 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2FNO2/c1-3-13(6-18,7-19)17-8(2)9-4-12(16)11(15)5-10(9)14/h4-5,8,17-19H,3,6-7H2,1-2H3 |
| InChIKey | BODFNXNCXDZVMM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|