C13H20FNO2 — CID 103935636
2-ethyl-2-[1-(4-fluorophenyl)ethylamino]propane-1,3-diol (PubChem CID 103935636) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-ethyl-2-[1-(4-fluorophenyl)ethylamino]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[1-(4-fluorophenyl)ethylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 103935636 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-ethyl-2-[1-(4-fluorophenyl)ethylamino]propane-1,3-diol |
| SMILES | CCC(CO)(CO)NC(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H20FNO2/c1-3-13(8-16,9-17)15-10(2)11-4-6-12(14)7-5-11/h4-7,10,15-17H,3,8-9H2,1-2H3 |
| InChIKey | NASXWCLJLCVWEU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |