C15H22F3NO — CID 62517490
2-ethyl-2-[1-[4-(trifluoromethyl)phenyl]ethylamino]butan-1-ol (PubChem CID 62517490) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-ethyl-2-[1-[4-(trifluoromethyl)phenyl]ethylamino]butan-1-ol.
| Compound Name | 2-ethyl-2-[1-[4-(trifluoromethyl)phenyl]ethylamino]butan-1-ol |
|---|---|
| PubChem CID | 62517490 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-ethyl-2-[1-[4-(trifluoromethyl)phenyl]ethylamino]butan-1-ol |
| SMILES | CCC(CC)(CO)NC(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H22F3NO/c1-4-14(5-2,10-20)19-11(3)12-6-8-13(9-7-12)15(16,17)18/h6-9,11,19-20H,4-5,10H2,1-3H3 |
| InChIKey | WXFPVWZLJFCOAW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |