C10H12Cl2FNO — CID 82709029
1-(2,4-dichloro-5-fluorophenyl)-N-ethoxyethanamine (PubChem CID 82709029) has the molecular formula C10H12Cl2FNO and a molecular weight of 252.12 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-N-ethoxyethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-N-ethoxyethanamine |
|---|---|
| PubChem CID | 82709029 |
| Molecular Formula | C10H12Cl2FNO |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-N-ethoxyethanamine |
| SMILES | CCONC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2FNO/c1-3-15-14-6(2)7-4-10(13)9(12)5-8(7)11/h4-6,14H,3H2,1-2H3 |
| InChIKey | FSBMUVPZDIOHMK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|