C15H22Cl2FN — CID 79298947
2-(2,4-dichloro-5-fluorophenyl)-4-methyl-N-propylpentan-3-amine (PubChem CID 79298947) has the molecular formula C15H22Cl2FN and a molecular weight of 306.25 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-4-methyl-N-propylpentan-3-amine.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-4-methyl-N-propylpentan-3-amine |
|---|---|
| PubChem CID | 79298947 |
| Molecular Formula | C15H22Cl2FN |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-4-methyl-N-propylpentan-3-amine |
| SMILES | CCCNC(C(C)C)C(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H22Cl2FN/c1-5-6-19-15(9(2)3)10(4)11-7-14(18)13(17)8-12(11)16/h7-10,15,19H,5-6H2,1-4H3 |
| InChIKey | XGHJQZNBESQERV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|