C13H18ClF2N — CID 107476598
1-(2-chloro-4,5-difluorophenyl)-N-propylbutan-1-amine (PubChem CID 107476598) has the molecular formula C13H18ClF2N and a molecular weight of 261.74 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-N-propylbutan-1-amine.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 107476598 |
| Molecular Formula | C13H18ClF2N |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-N-propylbutan-1-amine |
| SMILES | CCCNC(CCC)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H18ClF2N/c1-3-5-13(17-6-4-2)9-7-11(15)12(16)8-10(9)14/h7-8,13,17H,3-6H2,1-2H3 |
| InChIKey | FFYOTTKDTDTVRM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|